C13H11Cl2FN4O — CID 118080295
2-(3,5-dichloro-4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 118080295) has the molecular formula C13H11Cl2FN4O and a molecular weight of 329.16 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | 2-(3,5-dichloro-4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 118080295 |
| Molecular Formula | C13H11Cl2FN4O |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-(3,5-dichloro-4-fluorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | NC(=O)c1c(-c2cc(Cl)c(F)c(Cl)c2)nn2c1CNCC2 |
| InChI | InChI=1S/C13H11Cl2FN4O/c14-7-3-6(4-8(15)11(7)16)12-10(13(17)21)9-5-18-1-2-20(9)19-12/h3-4,18H,1-2,5H2,(H2,17,21) |
| InChIKey | RADHFJVTFOTFTI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|