C14H11BCl2N4O — CID 144845303
5-cyano-2-(3,4-dichlorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a][1,4]azaborinine-3-carboxamide (PubChem CID 144845303) has the molecular formula C14H11BCl2N4O and a molecular weight of 332.99 g/mol. Its IUPAC name is 5-cyano-2-(3,4-dichlorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a][1,4]azaborinine-3-carboxamide.
| Compound Name | 5-cyano-2-(3,4-dichlorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a][1,4]azaborinine-3-carboxamide |
|---|---|
| PubChem CID | 144845303 |
| Molecular Formula | C14H11BCl2N4O |
| Molecular Weight | 332.99 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-cyano-2-(3,4-dichlorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a][1,4]azaborinine-3-carboxamide |
| SMILES | N#CB1CCn2nc(-c3ccc(Cl)c(Cl)c3)c(C(N)=O)c2C1 |
| InChI | InChI=1S/C14H11BCl2N4O/c16-9-2-1-8(5-10(9)17)13-12(14(19)22)11-6-15(7-18)3-4-21(11)20-13/h1-2,5H,3-4,6H2,(H2,19,22) |
| InChIKey | XDYOMHWZIFENME-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.99 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|