C25H27ClN4O2 — CID 118081892
N-[[4-(2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)phenoxy]methyl]-1-imidazol-1-yl-N-methoxymethanamine (PubChem CID 118081892) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N-[[4-(2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)phenoxy]methyl]-1-imidazol-1-yl-N-methoxymethanamine.
| Compound Name | N-[[4-(2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)phenoxy]methyl]-1-imidazol-1-yl-N-methoxymethanamine |
|---|---|
| PubChem CID | 118081892 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[[4-(2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-6-yl)phenoxy]methyl]-1-imidazol-1-yl-N-methoxymethanamine |
| SMILES | CON(COc1ccc(C2CCCCc3c2[nH]c2ccc(Cl)cc32)cc1)Cn1ccnc1 |
| InChI | InChI=1S/C25H27ClN4O2/c1-31-30(16-29-13-12-27-15-29)17-32-20-9-6-18(7-10-20)21-4-2-3-5-22-23-14-19(26)8-11-24(23)28-25(21)22/h6-15,21,28H,2-5,16-17H2,1H3 |
| InChIKey | MZEBICMTKBSSFB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|