C21H20ClNO2 — CID 11667524
6-chloro-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 11667524) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 6-chloro-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 6-chloro-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 11667524 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 6-chloro-1-[4-(oxiran-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Clc1ccc2[nH]c3c(c2c1)CCCC3c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C21H20ClNO2/c22-14-6-9-20-19(10-14)18-3-1-2-17(21(18)23-20)13-4-7-15(8-5-13)24-11-16-12-25-16/h4-10,16-17,23H,1-3,11-12H2 |
| InChIKey | IKRZTRKTKFYDGT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|