C28H33NO8 — CID 118083081
methyl 3-amino-5-[4-hydroxy-7-[2-(2-hydroxyethyl)-3-(hydroxymethyl)-4,6-dioxoheptyl]-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]benzoate (PubChem CID 118083081) has the molecular formula C28H33NO8 and a molecular weight of 511.57 g/mol. Its IUPAC name is methyl 3-amino-5-[4-hydroxy-7-[2-(2-hydroxyethyl)-3-(hydroxymethyl)-4,6-dioxoheptyl]-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]benzoate.
| Compound Name | methyl 3-amino-5-[4-hydroxy-7-[2-(2-hydroxyethyl)-3-(hydroxymethyl)-4,6-dioxoheptyl]-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]benzoate |
|---|---|
| PubChem CID | 118083081 |
| Molecular Formula | C28H33NO8 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | methyl 3-amino-5-[4-hydroxy-7-[2-(2-hydroxyethyl)-3-(hydroxymethyl)-4,6-dioxoheptyl]-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]benzoate |
| SMILES | COC(=O)c1cc(N)cc(-c2ccc(O)c3c2CC(CC(CCO)C(CO)C(=O)CC(C)=O)CC3=O)c1 |
| InChI | InChI=1S/C28H33NO8/c1-15(32)7-25(34)23(14-31)17(5-6-30)8-16-9-22-21(3-4-24(33)27(22)26(35)10-16)18-11-19(28(36)37-2)13-20(29)12-18/h3-4,11-13,16-17,23,30-31,33H,5-10,14,29H2,1-2H3 |
| InChIKey | MNNXVJATUGJUAJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|