C10H7F5N2 — CID 118086708
4-[methyl(1,1,2,2,2-pentafluoroethyl)amino]benzonitrile (PubChem CID 118086708) has the molecular formula C10H7F5N2 and a molecular weight of 250.17 g/mol. Its IUPAC name is 4-[methyl(1,1,2,2,2-pentafluoroethyl)amino]benzonitrile.
| Compound Name | 4-[methyl(1,1,2,2,2-pentafluoroethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 118086708 |
| Molecular Formula | C10H7F5N2 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-[methyl(1,1,2,2,2-pentafluoroethyl)amino]benzonitrile |
| SMILES | CN(c1ccc(C#N)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F5N2/c1-17(10(14,15)9(11,12)13)8-4-2-7(6-16)3-5-8/h2-5H,1H3 |
| InChIKey | MYICALTVAUGIBF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|