C9H4F5N4O2- — CID 135962649
(Z)-[4-cyano-N-(1,1,2,2,2-pentafluoroethyl)anilino]-oxido-oxidoiminoazanium (PubChem CID 135962649) has the molecular formula C9H4F5N4O2- and a molecular weight of 295.15 g/mol. Its IUPAC name is (Z)-[4-cyano-N-(1,1,2,2,2-pentafluoroethyl)anilino]-oxido-oxidoiminoazanium.
| Compound Name | (Z)-[4-cyano-N-(1,1,2,2,2-pentafluoroethyl)anilino]-oxido-oxidoiminoazanium |
|---|---|
| PubChem CID | 135962649 |
| Molecular Formula | C9H4F5N4O2- |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (Z)-[4-cyano-N-(1,1,2,2,2-pentafluoroethyl)anilino]-oxido-oxidoiminoazanium |
| SMILES | N#Cc1ccc(N(/[N+]([O-])=N/[O-])C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H5F5N4O2/c10-8(11,12)9(13,14)17(18(20)16-19)7-3-1-6(5-15)2-4-7/h1-4,19H/p-1/b18-16- |
| InChIKey | STZVKIZCTFHPBZ-VLGSPTGOSA-M |
| XLogP | 2.90 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|