C15H16N2O4 — CID 118087115
(E)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-oxane]-3-yl)prop-2-enoic acid (PubChem CID 118087115) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is (E)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-oxane]-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-oxane]-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 118087115 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (E)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-oxane]-3-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc2c(c1)CC1(CCOCC1)C(=O)N2 |
| InChI | InChI=1S/C15H16N2O4/c18-12(19)2-1-10-7-11-8-15(3-5-21-6-4-15)14(20)17-13(11)16-9-10/h1-2,7,9H,3-6,8H2,(H,18,19)(H,16,17,20)/b2-1+ |
| InChIKey | IVRHGVXJZCFCQC-OWOJBTEDSA-N |
| XLogP | 1.47 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|