C28H27F3N4O3 — CID 123168576
6-[3-oxo-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)prop-1-enyl]-1'-(2,2,2-trifluoroacetyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one (PubChem CID 123168576) has the molecular formula C28H27F3N4O3 and a molecular weight of 524.54 g/mol. Its IUPAC name is 6-[3-oxo-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)prop-1-enyl]-1'-(2,2,2-trifluoroacetyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one.
| Compound Name | 6-[3-oxo-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)prop-1-enyl]-1'-(2,2,2-trifluoroacetyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 123168576 |
| Molecular Formula | C28H27F3N4O3 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 6-[3-oxo-3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)prop-1-enyl]-1'-(2,2,2-trifluoroacetyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one |
| SMILES | O=C(C=Cc1cnc2c(c1)CC1(CCN(C(=O)C(F)(F)F)CC1)C(=O)N2)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H27F3N4O3/c29-28(30,31)26(38)35-14-10-27(11-15-35)17-22-16-19(18-32-24(22)33-25(27)37)6-7-23(36)34-12-8-21(9-13-34)20-4-2-1-3-5-20/h1-8,16,18H,9-15,17H2,(H,32,33,37) |
| InChIKey | HIEYOXBFXFEQKO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|