C24H26N4O3S — CID 86296860
6-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-oxane]-2-one (PubChem CID 86296860) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-oxane]-2-one.
| Compound Name | 6-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 86296860 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 6-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-oxane]-2-one |
| SMILES | O=C(/C=C/c1cnc2c(c1)CC1(CCOCC1)C(=O)N2)N1CC=C(Cc2nccs2)CC1 |
| InChI | InChI=1S/C24H26N4O3S/c29-21(28-8-3-17(4-9-28)14-20-25-7-12-32-20)2-1-18-13-19-15-24(5-10-31-11-6-24)23(30)27-22(19)26-16-18/h1-3,7,12-13,16H,4-6,8-11,14-15H2,(H,26,27,30)/b2-1+ |
| InChIKey | VOLQBXQIKNYIOF-OWOJBTEDSA-N |
| XLogP | 3.24 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|