C29H35N5O4S — CID 123201531
tert-butyl 2-oxo-6-[3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-1'-carboxylate (PubChem CID 123201531) has the molecular formula C29H35N5O4S and a molecular weight of 549.70 g/mol. Its IUPAC name is tert-butyl 2-oxo-6-[3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 2-oxo-6-[3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 123201531 |
| Molecular Formula | C29H35N5O4S |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | tert-butyl 2-oxo-6-[3-oxo-3-[4-(1,3-thiazol-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)Cc1cc(C=CC(=O)N3CC=C(Cc4nccs4)CC3)cnc1NC2=O |
| InChI | InChI=1S/C29H35N5O4S/c1-28(2,3)38-27(37)34-13-8-29(9-14-34)18-22-16-21(19-31-25(22)32-26(29)36)4-5-24(35)33-11-6-20(7-12-33)17-23-30-10-15-39-23/h4-6,10,15-16,19H,7-9,11-14,17-18H2,1-3H3,(H,31,32,36) |
| InChIKey | GWUZKIGJFAMWBT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|