C30H36N4O3S — CID 86296862
1'-(2,2-dimethylpropanoyl)-6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one (PubChem CID 86296862) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is 1'-(2,2-dimethylpropanoyl)-6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one.
| Compound Name | 1'-(2,2-dimethylpropanoyl)-6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 86296862 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 1'-(2,2-dimethylpropanoyl)-6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one |
| SMILES | CC(C)(C)C(=O)N1CCC2(CC1)Cc1cc(/C=C/C(=O)N3CC=C(Cc4cccs4)CC3)cnc1NC2=O |
| InChI | InChI=1S/C30H36N4O3S/c1-29(2,3)28(37)34-14-10-30(11-15-34)19-23-17-22(20-31-26(23)32-27(30)36)6-7-25(35)33-12-8-21(9-13-33)18-24-5-4-16-38-24/h4-8,16-17,20H,9-15,18-19H2,1-3H3,(H,31,32,36)/b7-6+ |
| InChIKey | UFRMZRKUJHEWLX-VOTSOKGWSA-N |
| XLogP | 4.71 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|