C31H34N4O4S — CID 123337425
6-[3-[4-(3,4-dihydro-2H-thiopyran-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]-3-oxoprop-1-enyl]-1'-(furan-2-carbonyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one (PubChem CID 123337425) has the molecular formula C31H34N4O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is 6-[3-[4-(3,4-dihydro-2H-thiopyran-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]-3-oxoprop-1-enyl]-1'-(furan-2-carbonyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one.
| Compound Name | 6-[3-[4-(3,4-dihydro-2H-thiopyran-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]-3-oxoprop-1-enyl]-1'-(furan-2-carbonyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 123337425 |
| Molecular Formula | C31H34N4O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 6-[3-[4-(3,4-dihydro-2H-thiopyran-2-ylmethyl)-3,6-dihydro-2H-pyridin-1-yl]-3-oxoprop-1-enyl]-1'-(furan-2-carbonyl)spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one |
| SMILES | O=C(C=Cc1cnc2c(c1)CC1(CCN(C(=O)c3ccco3)CC1)C(=O)N2)N1CC=C(CC2CCC=CS2)CC1 |
| InChI | InChI=1S/C31H34N4O4S/c36-27(34-12-8-22(9-13-34)19-25-4-1-2-17-40-25)7-6-23-18-24-20-31(30(38)33-28(24)32-21-23)10-14-35(15-11-31)29(37)26-5-3-16-39-26/h2-3,5-8,16-18,21,25H,1,4,9-15,19-20H2,(H,32,33,38) |
| InChIKey | YRXAVAHKMOBJCI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|