C16H18N2O4 — CID 11808814
methyl (2S,4E)-1-benzoyl-4-(dimethylaminomethylidene)-5-oxopyrrolidine-2-carboxylate (PubChem CID 11808814) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (2S,4E)-1-benzoyl-4-(dimethylaminomethylidene)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4E)-1-benzoyl-4-(dimethylaminomethylidene)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11808814 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl (2S,4E)-1-benzoyl-4-(dimethylaminomethylidene)-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C/C(=C\N(C)C)C(=O)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O4/c1-17(2)10-12-9-13(16(21)22-3)18(15(12)20)14(19)11-7-5-4-6-8-11/h4-8,10,13H,9H2,1-3H3/b12-10+/t13-/m0/s1 |
| InChIKey | GJHFFDNIKOQLDO-XSNHNAGMSA-N |
| XLogP | 1.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|