C24H28F5N3O5 — CID 118089134
(2S,3S)-3-cyclohexyl-1-[2-(2,2-difluoroethylcarbamoyl)-1-benzofuran-5-yl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118089134) has the molecular formula C24H28F5N3O5 and a molecular weight of 533.49 g/mol. Its IUPAC name is (2S,3S)-3-cyclohexyl-1-[2-(2,2-difluoroethylcarbamoyl)-1-benzofuran-5-yl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3S)-3-cyclohexyl-1-[2-(2,2-difluoroethylcarbamoyl)-1-benzofuran-5-yl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118089134 |
| Molecular Formula | C24H28F5N3O5 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (2S,3S)-3-cyclohexyl-1-[2-(2,2-difluoroethylcarbamoyl)-1-benzofuran-5-yl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)[C@@H]1[C@H](C2CCCCC2)CCN1c1ccc2oc(C(=O)NCC(F)F)cc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27F2N3O3.C2HF3O2/c23-19(24)12-26-22(29)18-11-14-10-15(6-7-17(14)30-18)27-9-8-16(20(27)21(25)28)13-4-2-1-3-5-13;3-2(4,5)1(6)7/h6-7,10-11,13,16,19-20H,1-5,8-9,12H2,(H2,25,28)(H,26,29);(H,6,7)/t16-,20-;/m0./s1 |
| InChIKey | WLOLTRVSWZUDNL-XXRBRTKDSA-N |
| XLogP | 4.32 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |