C19H20N2O3 — CID 118089264
methyl 2-[(4S,5R)-5-carbamoyl-4-phenylpyrrolidin-3-yl]benzoate (PubChem CID 118089264) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 2-[(4S,5R)-5-carbamoyl-4-phenylpyrrolidin-3-yl]benzoate.
| Compound Name | methyl 2-[(4S,5R)-5-carbamoyl-4-phenylpyrrolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 118089264 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl 2-[(4S,5R)-5-carbamoyl-4-phenylpyrrolidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccccc1C1CN[C@@H](C(N)=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c1-24-19(23)14-10-6-5-9-13(14)15-11-21-17(18(20)22)16(15)12-7-3-2-4-8-12/h2-10,15-17,21H,11H2,1H3,(H2,20,22)/t15?,16-,17-/m1/s1 |
| InChIKey | NLBOCTIJGPPQAJ-YJEKIOLLSA-N |
| XLogP | 1.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |