C17H22O5 — CID 11808935
methyl (2E,4Z)-6-(methoxymethoxy)-4-(phenylmethoxymethyl)hexa-2,4-dienoate (PubChem CID 11808935) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl (2E,4Z)-6-(methoxymethoxy)-4-(phenylmethoxymethyl)hexa-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-6-(methoxymethoxy)-4-(phenylmethoxymethyl)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 11808935 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | methyl (2E,4Z)-6-(methoxymethoxy)-4-(phenylmethoxymethyl)hexa-2,4-dienoate |
| SMILES | COCOC/C=C(/C=C/C(=O)OC)COCc1ccccc1 |
| InChI | InChI=1S/C17H22O5/c1-19-14-21-11-10-16(8-9-17(18)20-2)13-22-12-15-6-4-3-5-7-15/h3-10H,11-14H2,1-2H3/b9-8+,16-10- |
| InChIKey | HZTAYOWWDZMLEK-GMCRPGLXSA-N |
| XLogP | 2.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|