C24H30N2O4 — CID 118089957
2-(diethoxymethyl)-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]furo[3,2-c]pyridine (PubChem CID 118089957) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-(diethoxymethyl)-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]furo[3,2-c]pyridine.
| Compound Name | 2-(diethoxymethyl)-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 118089957 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(diethoxymethyl)-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]furo[3,2-c]pyridine |
| SMILES | CCOC(OCC)c1cc2cncc(-c3cc(CN4CCCC4)ccc3OC)c2o1 |
| InChI | InChI=1S/C24H30N2O4/c1-4-28-24(29-5-2)22-13-18-14-25-15-20(23(18)30-22)19-12-17(8-9-21(19)27-3)16-26-10-6-7-11-26/h8-9,12-15,24H,4-7,10-11,16H2,1-3H3 |
| InChIKey | HIGVQFRBBYGLDG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|