C12H15NO2 — CID 153327457
5-(azetidin-1-ylmethyl)-2-methoxybenzaldehyde (PubChem CID 153327457) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-(azetidin-1-ylmethyl)-2-methoxybenzaldehyde.
| Compound Name | 5-(azetidin-1-ylmethyl)-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 153327457 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-(azetidin-1-ylmethyl)-2-methoxybenzaldehyde |
| SMILES | COc1ccc(CN2CCC2)cc1C=O |
| InChI | InChI=1S/C12H15NO2/c1-15-12-4-3-10(7-11(12)9-14)8-13-5-2-6-13/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | NYSLQCLDZRAZKV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|