C20H23NO2 — CID 11809038
(3S,4S,7S)-6-benzyl-4-methyl-7-phenyl-1-oxa-6-azaspiro[2.5]octan-4-ol (PubChem CID 11809038) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3S,4S,7S)-6-benzyl-4-methyl-7-phenyl-1-oxa-6-azaspiro[2.5]octan-4-ol.
| Compound Name | (3S,4S,7S)-6-benzyl-4-methyl-7-phenyl-1-oxa-6-azaspiro[2.5]octan-4-ol |
|---|---|
| PubChem CID | 11809038 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (3S,4S,7S)-6-benzyl-4-methyl-7-phenyl-1-oxa-6-azaspiro[2.5]octan-4-ol |
| SMILES | C[C@]1(O)CN(Cc2ccccc2)[C@H](c2ccccc2)C[C@]12CO2 |
| InChI | InChI=1S/C20H23NO2/c1-19(22)14-21(13-16-8-4-2-5-9-16)18(12-20(19)15-23-20)17-10-6-3-7-11-17/h2-11,18,22H,12-15H2,1H3/t18-,19-,20-/m0/s1 |
| InChIKey | WGUCDBYASCLTKJ-UFYCRDLUSA-N |
| XLogP | 3.15 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|