C17H34OSi2 — CID 11809086
tert-butyl-dimethyl-(3-methylidene-7-trimethylsilylhept-6-ynoxy)silane (PubChem CID 11809086) has the molecular formula C17H34OSi2 and a molecular weight of 310.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-methylidene-7-trimethylsilylhept-6-ynoxy)silane.
| Compound Name | tert-butyl-dimethyl-(3-methylidene-7-trimethylsilylhept-6-ynoxy)silane |
|---|---|
| PubChem CID | 11809086 |
| Molecular Formula | C17H34OSi2 |
| Molecular Weight | 310.63 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | tert-butyl-dimethyl-(3-methylidene-7-trimethylsilylhept-6-ynoxy)silane |
| SMILES | C=C(CCC#C[Si](C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34OSi2/c1-16(12-10-11-15-19(5,6)7)13-14-18-20(8,9)17(2,3)4/h1,10,12-14H2,2-9H3 |
| InChIKey | HPNKQEZRLTYBEB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|