C19H42O2Si2 — CID 155930752
tert-butyl-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-1-enoxy]-dimethylsilane (PubChem CID 155930752) has the molecular formula C19H42O2Si2 and a molecular weight of 358.72 g/mol. Its IUPAC name is tert-butyl-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-1-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-1-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 155930752 |
| Molecular Formula | C19H42O2Si2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | tert-butyl-[(Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-1-enoxy]-dimethylsilane |
| SMILES | C/C(=C/O[Si](C)(C)C(C)(C)C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O2Si2/c1-17(16-21-23(10,11)19(5,6)7)14-12-13-15-20-22(8,9)18(2,3)4/h16H,12-15H2,1-11H3/b17-16- |
| InChIKey | YJDQPBZPDZDVPA-MSUUIHNZSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|