C16H27NO5 — CID 11809166
(2R)-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(2R)-oxan-2-yl]acetamide (PubChem CID 11809166) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(2R)-oxan-2-yl]acetamide.
| Compound Name | (2R)-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(2R)-oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 11809166 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (2R)-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(2R)-oxan-2-yl]acetamide |
| SMILES | C=C1C[C@](OC)([C@@H](O)C(=O)N[C@H]2CCCCO2)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C16H27NO5/c1-10-9-16(20-4,22-12(3)11(10)2)14(18)15(19)17-13-7-5-6-8-21-13/h11-14,18H,1,5-9H2,2-4H3,(H,17,19)/t11-,12-,13-,14+,16-/m1/s1 |
| InChIKey | LHAJITSISKARSV-AQDIXCGQSA-N |
| XLogP | 1.33 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|