C16H12F3N5 — CID 118093083
5-pyridin-3-yl-3-N-[4-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 118093083) has the molecular formula C16H12F3N5 and a molecular weight of 331.30 g/mol. Its IUPAC name is 5-pyridin-3-yl-3-N-[4-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 5-pyridin-3-yl-3-N-[4-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 118093083 |
| Molecular Formula | C16H12F3N5 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-pyridin-3-yl-3-N-[4-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | Nc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cccnc2)c1 |
| InChI | InChI=1S/C16H12F3N5/c17-16(18,19)14-3-5-22-15(24-14)23-13-7-11(6-12(20)8-13)10-2-1-4-21-9-10/h1-9H,20H2,(H,22,23,24) |
| InChIKey | GAKOLZLLGCEKDX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|