C16H10F3N5O2 — CID 140674863
N-(3-nitro-5-pyridin-3-ylphenyl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 140674863) has the molecular formula C16H10F3N5O2 and a molecular weight of 361.28 g/mol. Its IUPAC name is N-(3-nitro-5-pyridin-3-ylphenyl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(3-nitro-5-pyridin-3-ylphenyl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 140674863 |
| Molecular Formula | C16H10F3N5O2 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(3-nitro-5-pyridin-3-ylphenyl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cccnc2)c1 |
| InChI | InChI=1S/C16H10F3N5O2/c17-16(18,19)14-3-5-21-15(23-14)22-12-6-11(7-13(8-12)24(25)26)10-2-1-4-20-9-10/h1-9H,(H,21,22,23) |
| InChIKey | YFSALJXWRLULKL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|