C24H33N5O4S — CID 118093992
N-cyclopentyl-3-[3-(dimethylamino)propylamino]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-5-sulfonamide (PubChem CID 118093992) has the molecular formula C24H33N5O4S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-cyclopentyl-3-[3-(dimethylamino)propylamino]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-5-sulfonamide.
| Compound Name | N-cyclopentyl-3-[3-(dimethylamino)propylamino]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 118093992 |
| Molecular Formula | C24H33N5O4S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-cyclopentyl-3-[3-(dimethylamino)propylamino]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-5-sulfonamide |
| SMILES | Cc1noc(C)c1-c1cc(S(=O)(=O)NC2CCCC2)c2cc(NCCCN(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H33N5O4S/c1-15-23(16(2)33-27-15)17-12-20-19(14-21(24(30)26-20)25-10-7-11-29(3)4)22(13-17)34(31,32)28-18-8-5-6-9-18/h12-14,18,25,28H,5-11H2,1-4H3,(H,26,30) |
| InChIKey | VNUZHMANYGIOJW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|