C23H30N4O6S — CID 118094036
N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-hydroxyethoxy)ethylamino]-2-oxo-1H-quinoline-5-sulfonamide (PubChem CID 118094036) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-hydroxyethoxy)ethylamino]-2-oxo-1H-quinoline-5-sulfonamide.
| Compound Name | N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-hydroxyethoxy)ethylamino]-2-oxo-1H-quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 118094036 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-hydroxyethoxy)ethylamino]-2-oxo-1H-quinoline-5-sulfonamide |
| SMILES | Cc1noc(C)c1-c1cc(S(=O)(=O)NC2CCCC2)c2cc(NCCOCCO)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H30N4O6S/c1-14-22(15(2)33-26-14)16-11-19-18(13-20(23(29)25-19)24-7-9-32-10-8-28)21(12-16)34(30,31)27-17-5-3-4-6-17/h11-13,17,24,27-28H,3-10H2,1-2H3,(H,25,29) |
| InChIKey | JULARUTUAWVEPR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 146.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|