About 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide
2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide (PubChem CID 118094028) has the molecular formula C19H20ClN3O3S
and a molecular weight of 405.91 g/mol. Its IUPAC name is 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide |
| PubChem CID | 118094028 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide |
| SMILES | Cc1noc(C)c1-c1cc(S(=O)(=O)NC2CCCC2)c2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C19H20ClN3O3S/c1-11-19(12(2)26-22-11)13-9-16-15(7-8-18(20)21-16)17(10-13)27(24,25)23-14-5-3-4-6-14/h7-10,14,23H,3-6H2,1-2H3 |
| InChIKey | RSYYMISEQQOCEP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide?
The IUPAC name of 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide (CID 118094028) is 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide?
The canonical SMILES for 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide is Cc1noc(C)c1-c1cc(S(=O)(=O)NC2CCCC2)c2ccc(Cl)nc2c1.
What is the InChIKey of 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide?
The InChIKey is RSYYMISEQQOCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN3O3S/c1-11-19(12(2)26-22-11)13-9-16-15(7-8-18(20)21-16)17(10-13)27(24,25)23-14-5-3-4-6-14/h7-10,14,23H,3-6H2,1-2H3.
What are the key properties of 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide?
2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide has a molecular weight of 405.91 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-cyclopentyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-sulfonamide is sourced from PubChem (CID 118094028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).