C19H22ClN3OS — CID 144852435
2-chloro-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-thiol;cyclopentanamine (PubChem CID 144852435) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is 2-chloro-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-thiol;cyclopentanamine.
| Compound Name | 2-chloro-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-thiol;cyclopentanamine |
|---|---|
| PubChem CID | 144852435 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-chloro-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoline-5-thiol;cyclopentanamine |
| SMILES | Cc1noc(C)c1-c1cc(S)c2ccc(Cl)nc2c1.NC1CCCC1 |
| InChI | InChI=1S/C14H11ClN2OS.C5H11N/c1-7-14(8(2)18-17-7)9-5-11-10(12(19)6-9)3-4-13(15)16-11;6-5-3-1-2-4-5/h3-6,19H,1-2H3;5H,1-4,6H2 |
| InChIKey | JCDZWKGGTPJVTD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|