C17H22N4OS2 — CID 144744126
cyclopentanamine;6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-sulfanyl-1,3-dihydrobenzimidazole-2-thione (PubChem CID 144744126) has the molecular formula C17H22N4OS2 and a molecular weight of 362.52 g/mol. Its IUPAC name is cyclopentanamine;6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-sulfanyl-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | cyclopentanamine;6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-sulfanyl-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 144744126 |
| Molecular Formula | C17H22N4OS2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | cyclopentanamine;6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-sulfanyl-1,3-dihydrobenzimidazole-2-thione |
| SMILES | Cc1noc(C)c1-c1cc(S)c2[nH]c(=S)[nH]c2c1.NC1CCCC1 |
| InChI | InChI=1S/C12H11N3OS2.C5H11N/c1-5-10(6(2)16-15-5)7-3-8-11(9(17)4-7)14-12(18)13-8;6-5-3-1-2-4-5/h3-4,17H,1-2H3,(H2,13,14,18);5H,1-4,6H2 |
| InChIKey | WHOJUNKNABWTFB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|