C16H17ClN4O2 — CID 118095196
ethyl 2-[azido-(4-chlorophenyl)methyl]-1,4-dimethylpyrrole-3-carboxylate (PubChem CID 118095196) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is ethyl 2-[azido-(4-chlorophenyl)methyl]-1,4-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-[azido-(4-chlorophenyl)methyl]-1,4-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 118095196 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | ethyl 2-[azido-(4-chlorophenyl)methyl]-1,4-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)cn(C)c1C(N=[N+]=[N-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-4-23-16(22)13-10(2)9-21(3)15(13)14(19-20-18)11-5-7-12(17)8-6-11/h5-9,14H,4H2,1-3H3 |
| InChIKey | JBSGICQTGLVYEE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|