C16H18BrClN5O2+ — CID 149172010
[(2-bromo-5-ethoxycarbonyl-3-propan-2-ylimidazol-4-yl)-(4-chlorophenyl)methyl]imino-iminoazanium (PubChem CID 149172010) has the molecular formula C16H18BrClN5O2+ and a molecular weight of 427.71 g/mol. Its IUPAC name is [(2-bromo-5-ethoxycarbonyl-3-propan-2-ylimidazol-4-yl)-(4-chlorophenyl)methyl]imino-iminoazanium.
| Compound Name | [(2-bromo-5-ethoxycarbonyl-3-propan-2-ylimidazol-4-yl)-(4-chlorophenyl)methyl]imino-iminoazanium |
|---|---|
| PubChem CID | 149172010 |
| Molecular Formula | C16H18BrClN5O2+ |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | [(2-bromo-5-ethoxycarbonyl-3-propan-2-ylimidazol-4-yl)-(4-chlorophenyl)methyl]imino-iminoazanium |
| SMILES | CCOC(=O)c1nc(Br)n(C(C)C)c1C(N=[N+]=N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18BrClN5O2/c1-4-25-15(24)13-14(23(9(2)3)16(17)20-13)12(21-22-19)10-5-7-11(18)8-6-10/h5-9,12,19H,4H2,1-3H3/q+1 |
| InChIKey | WZFXKVXJKTXLBS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|