C13H12BrClN2O3 — CID 142795680
ethyl 2-bromo-5-[(4-chlorophenyl)-hydroxymethyl]-1H-imidazole-4-carboxylate (PubChem CID 142795680) has the molecular formula C13H12BrClN2O3 and a molecular weight of 359.61 g/mol. Its IUPAC name is ethyl 2-bromo-5-[(4-chlorophenyl)-hydroxymethyl]-1H-imidazole-4-carboxylate.
| Compound Name | ethyl 2-bromo-5-[(4-chlorophenyl)-hydroxymethyl]-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 142795680 |
| Molecular Formula | C13H12BrClN2O3 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | ethyl 2-bromo-5-[(4-chlorophenyl)-hydroxymethyl]-1H-imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(Br)[nH]c1C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12BrClN2O3/c1-2-20-12(19)10-9(16-13(14)17-10)11(18)7-3-5-8(15)6-4-7/h3-6,11,18H,2H2,1H3,(H,16,17) |
| InChIKey | JBDNLNLKUKOLCE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |