C10H10N4O5 — CID 118095906
2-[(5-nitro-1H-indazol-6-yl)oxy]ethylcarbamic acid (PubChem CID 118095906) has the molecular formula C10H10N4O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is 2-[(5-nitro-1H-indazol-6-yl)oxy]ethylcarbamic acid.
| Compound Name | 2-[(5-nitro-1H-indazol-6-yl)oxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 118095906 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[(5-nitro-1H-indazol-6-yl)oxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOc1cc2[nH]ncc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O5/c15-10(16)11-1-2-19-9-4-7-6(5-12-13-7)3-8(9)14(17)18/h3-5,11H,1-2H2,(H,12,13)(H,15,16) |
| InChIKey | FWGXSJFRJCNUQS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|