C16H23FN2O6S — CID 118098743
tert-butyl N-[(3-fluoro-5-nitro-2-propan-2-ylsulfonylphenyl)methyl]-N-methylcarbamate (PubChem CID 118098743) has the molecular formula C16H23FN2O6S and a molecular weight of 390.43 g/mol. Its IUPAC name is tert-butyl N-[(3-fluoro-5-nitro-2-propan-2-ylsulfonylphenyl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3-fluoro-5-nitro-2-propan-2-ylsulfonylphenyl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118098743 |
| Molecular Formula | C16H23FN2O6S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | tert-butyl N-[(3-fluoro-5-nitro-2-propan-2-ylsulfonylphenyl)methyl]-N-methylcarbamate |
| SMILES | CC(C)S(=O)(=O)c1c(F)cc([N+](=O)[O-])cc1CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23FN2O6S/c1-10(2)26(23,24)14-11(7-12(19(21)22)8-13(14)17)9-18(6)15(20)25-16(3,4)5/h7-8,10H,9H2,1-6H3 |
| InChIKey | QLSHHPTZQZSAEV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|