C20H33NO2 — CID 118099311
2-methylbutan-2-yl 5-(4-butan-2-ylanilino)pentanoate (PubChem CID 118099311) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2-methylbutan-2-yl 5-(4-butan-2-ylanilino)pentanoate.
| Compound Name | 2-methylbutan-2-yl 5-(4-butan-2-ylanilino)pentanoate |
|---|---|
| PubChem CID | 118099311 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 2-methylbutan-2-yl 5-(4-butan-2-ylanilino)pentanoate |
| SMILES | CCC(C)c1ccc(NCCCCC(=O)OC(C)(C)CC)cc1 |
| InChI | InChI=1S/C20H33NO2/c1-6-16(3)17-11-13-18(14-12-17)21-15-9-8-10-19(22)23-20(4,5)7-2/h11-14,16,21H,6-10,15H2,1-5H3 |
| InChIKey | PDGBOJLGGZHHHY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|