C16H22F3NO2 — CID 121308537
2,2,2-trifluoroethyl 4-(4-butan-2-ylanilino)butanoate (PubChem CID 121308537) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(4-butan-2-ylanilino)butanoate.
| Compound Name | 2,2,2-trifluoroethyl 4-(4-butan-2-ylanilino)butanoate |
|---|---|
| PubChem CID | 121308537 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(4-butan-2-ylanilino)butanoate |
| SMILES | CCC(C)c1ccc(NCCCC(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO2/c1-3-12(2)13-6-8-14(9-7-13)20-10-4-5-15(21)22-11-16(17,18)19/h6-9,12,20H,3-5,10-11H2,1-2H3 |
| InChIKey | BTTBZKYTUJGGOA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|