C42H56F3NO3 — CID 162053716
5-(4-butan-2-ylanilino)pentanoic acid;1-butan-2-ylnaphthalene;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 162053716) has the molecular formula C42H56F3NO3 and a molecular weight of 679.91 g/mol. Its IUPAC name is 5-(4-butan-2-ylanilino)pentanoic acid;1-butan-2-ylnaphthalene;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 5-(4-butan-2-ylanilino)pentanoic acid;1-butan-2-ylnaphthalene;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 162053716 |
| Molecular Formula | C42H56F3NO3 |
| Molecular Weight | 679.91 g/mol |
| Exact Mass | 679.42 |
| IUPAC Name | 5-(4-butan-2-ylanilino)pentanoic acid;1-butan-2-ylnaphthalene;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCC(C)c1ccc(C(C)(O)C(F)(F)F)cc1.CCC(C)c1ccc(NCCCCC(=O)O)cc1.CCC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H23NO2.C14H16.C13H17F3O/c1-3-12(2)13-7-9-14(10-8-13)16-11-5-4-6-15(17)18;1-3-11(2)13-10-6-8-12-7-4-5-9-14(12)13;1-4-9(2)10-5-7-11(8-6-10)12(3,17)13(14,15)16/h7-10,12,16H,3-6,11H2,1-2H3,(H,17,18);4-11H,3H2,1-2H3;5-9,17H,4H2,1-3H3 |
| InChIKey | YYWUYRFRUZOKJX-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.91 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|