C21H31NSi2 — CID 11810352
2-benzyl-1,1,3,3-tetraethyl-2,1,3-benzazadisilole (PubChem CID 11810352) has the molecular formula C21H31NSi2 and a molecular weight of 353.66 g/mol. Its IUPAC name is 2-benzyl-1,1,3,3-tetraethyl-2,1,3-benzazadisilole.
| Compound Name | 2-benzyl-1,1,3,3-tetraethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 11810352 |
| Molecular Formula | C21H31NSi2 |
| Molecular Weight | 353.66 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-benzyl-1,1,3,3-tetraethyl-2,1,3-benzazadisilole |
| SMILES | CC[Si]1(CC)c2ccccc2[Si](CC)(CC)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NSi2/c1-5-23(6-2)20-16-12-13-17-21(20)24(7-3,8-4)22(23)18-19-14-10-9-11-15-19/h9-17H,5-8,18H2,1-4H3 |
| InChIKey | QAOVUCULXBMNHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|