C18H23NSi2 — CID 12736307
1,1,3,3-tetramethyl-2-[(E)-2-phenylethenyl]-2,1,3-benzazadisilole (PubChem CID 12736307) has the molecular formula C18H23NSi2 and a molecular weight of 309.56 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[(E)-2-phenylethenyl]-2,1,3-benzazadisilole.
| Compound Name | 1,1,3,3-tetramethyl-2-[(E)-2-phenylethenyl]-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 12736307 |
| Molecular Formula | C18H23NSi2 |
| Molecular Weight | 309.56 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[(E)-2-phenylethenyl]-2,1,3-benzazadisilole |
| SMILES | C[Si]1(C)c2ccccc2[Si](C)(C)N1/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H23NSi2/c1-20(2)17-12-8-9-13-18(17)21(3,4)19(20)15-14-16-10-6-5-7-11-16/h5-15H,1-4H3/b15-14+ |
| InChIKey | NMHHQTVTNXJRBN-CCEZHUSRSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|