C14H23NSi2 — CID 12736306
1,1,3,3-tetramethyl-2-(2-methylprop-1-enyl)-2,1,3-benzazadisilole (PubChem CID 12736306) has the molecular formula C14H23NSi2 and a molecular weight of 261.52 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-methylprop-1-enyl)-2,1,3-benzazadisilole.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-methylprop-1-enyl)-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 12736306 |
| Molecular Formula | C14H23NSi2 |
| Molecular Weight | 261.52 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-methylprop-1-enyl)-2,1,3-benzazadisilole |
| SMILES | CC(C)=CN1[Si](C)(C)c2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C14H23NSi2/c1-12(2)11-15-16(3,4)13-9-7-8-10-14(13)17(15,5)6/h7-11H,1-6H3 |
| InChIKey | URBZRLAQSNIEOO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|