C13H21NSi2 — CID 134932131
1,1,3,3-tetramethyl-2-[(Z)-prop-1-enyl]-2,1,3-benzazadisilole (PubChem CID 134932131) has the molecular formula C13H21NSi2 and a molecular weight of 247.49 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[(Z)-prop-1-enyl]-2,1,3-benzazadisilole.
| Compound Name | 1,1,3,3-tetramethyl-2-[(Z)-prop-1-enyl]-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134932131 |
| Molecular Formula | C13H21NSi2 |
| Molecular Weight | 247.49 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[(Z)-prop-1-enyl]-2,1,3-benzazadisilole |
| SMILES | C/C=C\N1[Si](C)(C)c2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C13H21NSi2/c1-6-11-14-15(2,3)12-9-7-8-10-13(12)16(14,4)5/h6-11H,1-5H3/b11-6- |
| InChIKey | GVDOMWMGYITDAD-WDZFZDKYSA-N |
| XLogP | 2.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|