C15H22N2Si2 — CID 134932624
(Z)-3-methyl-4-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)but-3-enenitrile (PubChem CID 134932624) has the molecular formula C15H22N2Si2 and a molecular weight of 286.53 g/mol. Its IUPAC name is (Z)-3-methyl-4-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)but-3-enenitrile.
| Compound Name | (Z)-3-methyl-4-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)but-3-enenitrile |
|---|---|
| PubChem CID | 134932624 |
| Molecular Formula | C15H22N2Si2 |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (Z)-3-methyl-4-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)but-3-enenitrile |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)CC#N |
| InChI | InChI=1S/C15H22N2Si2/c1-13(10-11-16)12-17-18(2,3)14-8-6-7-9-15(14)19(17,4)5/h6-9,12H,10H2,1-5H3/b13-12- |
| InChIKey | XDOLSBFAPDGDAQ-SEYXRHQNSA-N |
| XLogP | 2.64 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|