C17H26N2Si2 — CID 134932625
(Z)-5-methyl-6-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)hex-5-enenitrile (PubChem CID 134932625) has the molecular formula C17H26N2Si2 and a molecular weight of 314.58 g/mol. Its IUPAC name is (Z)-5-methyl-6-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)hex-5-enenitrile.
| Compound Name | (Z)-5-methyl-6-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)hex-5-enenitrile |
|---|---|
| PubChem CID | 134932625 |
| Molecular Formula | C17H26N2Si2 |
| Molecular Weight | 314.58 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (Z)-5-methyl-6-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)hex-5-enenitrile |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)CCCC#N |
| InChI | InChI=1S/C17H26N2Si2/c1-15(10-8-9-13-18)14-19-20(2,3)16-11-6-7-12-17(16)21(19,4)5/h6-7,11-12,14H,8-10H2,1-5H3/b15-14- |
| InChIKey | LQACBZAABRRXBC-PFONDFGASA-N |
| XLogP | 3.42 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|