C14H20N2Si2 — CID 134932490
(Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enenitrile (PubChem CID 134932490) has the molecular formula C14H20N2Si2 and a molecular weight of 272.50 g/mol. Its IUPAC name is (Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 134932490 |
| Molecular Formula | C14H20N2Si2 |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enenitrile |
| SMILES | C/C(C#N)=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C14H20N2Si2/c1-12(10-15)11-16-17(2,3)13-8-6-7-9-14(13)18(16,4)5/h6-9,11H,1-5H3/b12-11- |
| InChIKey | LARHRFSAOJMTHR-QXMHVHEDSA-N |
| XLogP | 2.25 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|