C16H26BrNSi2 — CID 134932133
2-[(Z)-5-bromo-2-methylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 134932133) has the molecular formula C16H26BrNSi2 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-[(Z)-5-bromo-2-methylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-[(Z)-5-bromo-2-methylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134932133 |
| Molecular Formula | C16H26BrNSi2 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[(Z)-5-bromo-2-methylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)CCCBr |
| InChI | InChI=1S/C16H26BrNSi2/c1-14(9-8-12-17)13-18-19(2,3)15-10-6-7-11-16(15)20(18,4)5/h6-7,10-11,13H,8-9,12H2,1-5H3/b14-13- |
| InChIKey | JWSJNDOWRUXIPV-YPKPFQOOSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|