C21H28BrNSi2 — CID 134933047
2-[(E)-5-bromo-2-phenylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 134933047) has the molecular formula C21H28BrNSi2 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-[(E)-5-bromo-2-phenylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-[(E)-5-bromo-2-phenylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134933047 |
| Molecular Formula | C21H28BrNSi2 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-[(E)-5-bromo-2-phenylpent-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | C[Si]1(C)c2ccccc2[Si](C)(C)N1/C=C(\CCCBr)c1ccccc1 |
| InChI | InChI=1S/C21H28BrNSi2/c1-24(2)20-14-8-9-15-21(20)25(3,4)23(24)17-19(13-10-16-22)18-11-6-5-7-12-18/h5-9,11-12,14-15,17H,10,13,16H2,1-4H3/b19-17+ |
| InChIKey | ZZRMVOLOLAUFSH-HTXNQAPBSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|