C19H25NSi2 — CID 134932623
1,1,3,3-tetramethyl-2-[(Z)-3-phenylprop-1-enyl]-2,1,3-benzazadisilole (PubChem CID 134932623) has the molecular formula C19H25NSi2 and a molecular weight of 323.59 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[(Z)-3-phenylprop-1-enyl]-2,1,3-benzazadisilole.
| Compound Name | 1,1,3,3-tetramethyl-2-[(Z)-3-phenylprop-1-enyl]-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134932623 |
| Molecular Formula | C19H25NSi2 |
| Molecular Weight | 323.59 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[(Z)-3-phenylprop-1-enyl]-2,1,3-benzazadisilole |
| SMILES | C[Si]1(C)c2ccccc2[Si](C)(C)N1/C=C\Cc1ccccc1 |
| InChI | InChI=1S/C19H25NSi2/c1-21(2)18-14-8-9-15-19(18)22(3,4)20(21)16-10-13-17-11-6-5-7-12-17/h5-12,14-16H,13H2,1-4H3/b16-10- |
| InChIKey | WXUXTBJMGFNVHZ-YBEGLDIGSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|