C16H27NSi2 — CID 13332929
(1E,3E)-4-phenyl-N,N-bis(trimethylsilyl)buta-1,3-dien-1-amine (PubChem CID 13332929) has the molecular formula C16H27NSi2 and a molecular weight of 289.57 g/mol. Its IUPAC name is (1E,3E)-4-phenyl-N,N-bis(trimethylsilyl)buta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-4-phenyl-N,N-bis(trimethylsilyl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 13332929 |
| Molecular Formula | C16H27NSi2 |
| Molecular Weight | 289.57 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (1E,3E)-4-phenyl-N,N-bis(trimethylsilyl)buta-1,3-dien-1-amine |
| SMILES | C[Si](C)(C)N(/C=C/C=C/c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H27NSi2/c1-18(2,3)17(19(4,5)6)15-11-10-14-16-12-8-7-9-13-16/h7-15H,1-6H3/b14-10+,15-11+ |
| InChIKey | GVKQHQNCVWGPKB-WFYKWJGLSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|