C16H20BClF3NSi — CID 122211913
tert-butyl-[2-chloro-3-(3,4,5-trifluorophenyl)azaborinin-1-yl]-dimethylsilane (PubChem CID 122211913) has the molecular formula C16H20BClF3NSi and a molecular weight of 357.69 g/mol. Its IUPAC name is tert-butyl-[2-chloro-3-(3,4,5-trifluorophenyl)azaborinin-1-yl]-dimethylsilane.
| Compound Name | tert-butyl-[2-chloro-3-(3,4,5-trifluorophenyl)azaborinin-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 122211913 |
| Molecular Formula | C16H20BClF3NSi |
| Molecular Weight | 357.69 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | tert-butyl-[2-chloro-3-(3,4,5-trifluorophenyl)azaborinin-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)N1C=CC=C(c2cc(F)c(F)c(F)c2)B1Cl |
| InChI | InChI=1S/C16H20BClF3NSi/c1-16(2,3)23(4,5)22-8-6-7-12(17(22)18)11-9-13(19)15(21)14(20)10-11/h6-10H,1-5H3 |
| InChIKey | AEDDOBKVRQQJQR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|